CAS
1451392-28-1 Purity
---
1451392-28-1 Purity
---
Inquiry Basket
3-(Hydroxymethyl)-5-methylphenylboronic acid
CAS
1451391-46-0
Catalog Number
ACM1451391460
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-(Hydroxymethyl)-5-methylphenylboronic acid?
The molecular formula of 3-(Hydroxymethyl)-5-methylphenylboronic acid is C8H11BO3.
What is the molecular weight of 3-(Hydroxymethyl)-5-methylphenylboronic acid?
The molecular weight of 3-(Hydroxymethyl)-5-methylphenylboronic acid is 165.98 g/mol.
When was 3-(Hydroxymethyl)-5-methylphenylboronic acid created?
3-(Hydroxymethyl)-5-methylphenylboronic acid was created on August 8, 2012.
What is the IUPAC name of the compound?
The IUPAC name of the compound is [3-(hydroxymethyl)-5-methylphenyl]boronic acid.
What is the InChI of 3-(Hydroxymethyl)-5-methylphenylboronic acid?
The InChI of 3-(Hydroxymethyl)-5-methylphenylboronic acid is InChI=1S/C8H11BO3/c1-6-2-7(5-10)4-8(3-6)9(11)12/h2-4,10-12H,5H2,1H3.
What is the InChIKey of 3-(Hydroxymethyl)-5-methylphenylboronic acid?
The InChIKey of 3-(Hydroxymethyl)-5-methylphenylboronic acid is XAHBYOREXCQDRQ-UHFFFAOYSA-N.
What is the canonical SMILES of 3-(Hydroxymethyl)-5-methylphenylboronic acid?
The canonical SMILES of 3-(Hydroxymethyl)-5-methylphenylboronic acid is B(C1=CC(=CC(=C1)CO)C)(O)O.
What is the CAS number of 3-(Hydroxymethyl)-5-methylphenylboronic acid?
The CAS number of 3-(Hydroxymethyl)-5-methylphenylboronic acid is 1451391-46-0.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 3.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
CAS
1451392-31-6 Purity
---
1451392-31-6 Purity
---
CAS
1264616-16-1 Purity
---
1264616-16-1 Purity
---
