CAS
1451392-26-9 Purity
---
1451392-26-9 Purity
---
Inquiry Basket
3-Chloro-5-fluoro-4-(methoxymethoxy)phenylboronic acid
CAS
1451392-28-1
Catalog Number
ACM1451392281
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C8H9BClFO4.
What is the molecular weight of the compound?
The molecular weight of the compound is 234.42 g/mol.
When was the compound created?
The compound was created on August 8, 2012.
When was the compound last modified?
The compound was last modified on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is [3-chloro-5-fluoro-4-(methoxymethoxy)phenyl]boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H9BClFO4/c1-14-4-15-8-6(10)2-5(9(12)13)3-7(8)11/h2-3,12-13H,4H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is FIVLKFXAIHOFFM-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=CC(=C(C(=C1)Cl)OCOC)F)(O)O.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 5 hydrogen bond acceptor counts.
Recommended Products
CAS
1451392-31-6 Purity
---
1451392-31-6 Purity
---
