What is the molecular formula of 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid?
The molecular formula is C8H9BF2O4.
What is the molecular weight of 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid?
The molecular weight is 217.96 g/mol.
When was 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid created?
It was created on August 8, 2012.
When was 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid?
The IUPAC name is [2,5-difluoro-4-(methoxymethoxy)phenyl]boronic acid.
What is the InChI of 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid?
The InChI is InChI=1S/C8H9BF2O4/c1-14-4-15-8-3-6(10)5(9(12)13)2-7(8)11/h2-3,12-13H,4H2,1H3.
What is the InChIKey of 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid?
The InChIKey is XQIXENAYGSXYMJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid?
The canonical SMILES is B(C1=CC(=C(C=C1F)OCOC)F)(O)O.
How many hydrogen bond donor counts does 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid have?
It has 6 hydrogen bond acceptor counts.