3-(N,O-Dimethylhydroxylaminocarbonyl)-5-fluorophenylboronic acid

• CAS: 1451392-31-6
• Catalog Number: ACM1451392316
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 3-(N,O-Dimethylhydroxylaminocarbonyl)-5-fluorophenylboronic acid?

The molecular formula is C9H11BFNO4.

What is the molecular weight of 3-(N,O-Dimethylhydroxylaminocarbonyl)-5-fluorophenylboronic acid?

The molecular weight is 227.00 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is [3-fluoro-5-[methoxy(methyl)carbamoyl]phenyl]boronic acid.

What is the InChI of 3-(N,O-Dimethylhydroxylaminocarbonyl)-5-fluorophenylboronic acid?

The InChI is InChI=1S/C9H11BFNO4/c1-12(16-2)9(13)6-3-7(10(14)15)5-8(11)4-6/h3-5,14-15H,1-2H3.

What is the InChIKey of the compound?

The InChIKey is KQSBAHYEQPZQMF-UHFFFAOYSA-N.

How many hydrogen bond donor counts are present in the compound?

There are 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts are present in the compound?

There are 5 hydrogen bond acceptor counts.

What is the exact mass of 3-(N,O-Dimethylhydroxylaminocarbonyl)-5-fluorophenylboronic acid?

The exact mass is 227.0765162 g/mol.

How many rotatable bond counts are there in the compound?

There are 3 rotatable bond counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.