CAS
1451391-46-0 Purity
---
1451391-46-0 Purity
---
Inquiry Basket
2,6-Dichloro-4-formylphenylboronic acid
CAS
1451392-98-5
Catalog Number
ACM1451392985
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,6-Dichloro-4-formylphenylboronic acid?
The molecular formula of 2,6-Dichloro-4-formylphenylboronic acid is C7H5BCl2O3.
What is the molecular weight of 2,6-Dichloro-4-formylphenylboronic acid?
The molecular weight of 2,6-Dichloro-4-formylphenylboronic acid is 218.83 g/mol.
When was 2,6-Dichloro-4-formylphenylboronic acid created?
2,6-Dichloro-4-formylphenylboronic acid was created on August 8, 2012.
When was 2,6-Dichloro-4-formylphenylboronic acid last modified?
2,6-Dichloro-4-formylphenylboronic acid was last modified on December 2, 2023.
What is the IUPAC name of 2,6-Dichloro-4-formylphenylboronic acid?
The IUPAC name of 2,6-Dichloro-4-formylphenylboronic acid is (2,6-dichloro-4-formylphenyl)boronic acid.
What is the InChI key of 2,6-Dichloro-4-formylphenylboronic acid?
The InChI key of 2,6-Dichloro-4-formylphenylboronic acid is JIIZYKDHZYFDOO-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2,6-Dichloro-4-formylphenylboronic acid?
The canonical SMILES representation of 2,6-Dichloro-4-formylphenylboronic acid is B(C1=C(C=C(C=C1Cl)C=O)Cl)(O)O.
What is the CAS number of 2,6-Dichloro-4-formylphenylboronic acid?
The CAS number of 2,6-Dichloro-4-formylphenylboronic acid is 1451392-98-5.
What is the hydrogen bond donor count of 2,6-Dichloro-4-formylphenylboronic acid?
The hydrogen bond donor count of 2,6-Dichloro-4-formylphenylboronic acid is 2.
What is the hydrogen bond acceptor count of 2,6-Dichloro-4-formylphenylboronic acid?
The hydrogen bond acceptor count of 2,6-Dichloro-4-formylphenylboronic acid is 3.
Recommended Products
CAS
1264616-16-1 Purity
---
1264616-16-1 Purity
---
