4-Benzyloxy-3-fluorophenylboronic acid

• CAS: 133057-83-7
• Catalog Number: ACM133057837
• Category: Boronic Acids
• Molecular Weight: 246.04
• Molecular Formula: C₁₃H₁₂BFO₃
• Synonyms: AKOS BRN-0078;4-BENZYLOXY-3-FLUOROBENZENEBORONIC ACID;4-BENZYLOXY-3-FLUOROPHENYLBORONIC ACID;(3-FLUORO-4-BENZYLOXYPHENYL)BORONIC ACID;1-formylphenylboronic acid;4-Benzyloxy-3-fluorophenylboro;4-Benzyloxy-3-fluorobenzeneboronic acid 97%;4-Benzyloxy-3-fluor

Custom Q&A

What is the molecular formula of 4-Benzyloxy-3-fluorophenylboronic acid?

The molecular formula of 4-Benzyloxy-3-fluorophenylboronic acid is C13H12BFO3.

What is the molecular weight of 4-Benzyloxy-3-fluorophenylboronic acid?

The molecular weight of 4-Benzyloxy-3-fluorophenylboronic acid is 246.04 g/mol.

What is the IUPAC name of 4-Benzyloxy-3-fluorophenylboronic acid?

The IUPAC name of 4-Benzyloxy-3-fluorophenylboronic acid is (3-fluoro-4-phenylmethoxyphenyl)boronic acid.

What is the InChI of 4-Benzyloxy-3-fluorophenylboronic acid?

The InChI of 4-Benzyloxy-3-fluorophenylboronic acid is InChI=1S/C13H12BFO3/c15-12-8-11(14(16)17)6-7-13(12)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2.

What is the InChIKey of 4-Benzyloxy-3-fluorophenylboronic acid?

The InChIKey of 4-Benzyloxy-3-fluorophenylboronic acid is DQPDLDQJMUGVGI-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Benzyloxy-3-fluorophenylboronic acid?

The canonical SMILES of 4-Benzyloxy-3-fluorophenylboronic acid is B(C1=CC(=C(C=C1)OCC2=CC=CC=C2)F)(O)O.

What is the CAS number of 4-Benzyloxy-3-fluorophenylboronic acid?

The CAS number of 4-Benzyloxy-3-fluorophenylboronic acid is 133057-83-7.

What is the EC number of 4-Benzyloxy-3-fluorophenylboronic acid?

The EC number of 4-Benzyloxy-3-fluorophenylboronic acid is 675-638-1.

What is the hydrogen bond donor count of 4-Benzyloxy-3-fluorophenylboronic acid?

The hydrogen bond donor count of 4-Benzyloxy-3-fluorophenylboronic acid is 2.

What is the hydrogen bond acceptor count of 4-Benzyloxy-3-fluorophenylboronic acid?

The hydrogen bond acceptor count of 4-Benzyloxy-3-fluorophenylboronic acid is 4.