3-Chloro-4-(methoxymethoxy)phenylboronic acid

• CAS: 1451392-27-0
• Catalog Number: ACM1451392270
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 3-Chloro-4-(methoxymethoxy)phenylboronic acid?

The molecular formula of 3-Chloro-4-(methoxymethoxy)phenylboronic acid is C8H10BClO4.

What are the synonyms for 3-Chloro-4-(methoxymethoxy)phenylboronic acid?

The synonyms for 3-Chloro-4-(methoxymethoxy)phenylboronic acid include 1451392-27-0, [3-chloro-4-(methoxymethoxy)phenyl]boronic acid, (3-Chloro-4-(methoxymethoxy)phenyl)boronic acid, and BIC39227.

What is the molecular weight of 3-Chloro-4-(methoxymethoxy)phenylboronic acid?

The molecular weight of 3-Chloro-4-(methoxymethoxy)phenylboronic acid is 216.43 g/mol.

What is the IUPAC name of 3-Chloro-4-(methoxymethoxy)phenylboronic acid?

The IUPAC name of 3-Chloro-4-(methoxymethoxy)phenylboronic acid is [3-chloro-4-(methoxymethoxy)phenyl]boronic acid.

What is the InChI of 3-Chloro-4-(methoxymethoxy)phenylboronic acid?

The InChI of 3-Chloro-4-(methoxymethoxy)phenylboronic acid is InChI=1S/C8H10BClO4/c1-13-5-14-8-3-2-6(9(11)12)4-7(8)10/h2-4,11-12H,5H2,1H3.

What is the InChIKey of 3-Chloro-4-(methoxymethoxy)phenylboronic acid?

The InChIKey of 3-Chloro-4-(methoxymethoxy)phenylboronic acid is ISTZDEQGOZACDO-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Chloro-4-(methoxymethoxy)phenylboronic acid?

The canonical SMILES of 3-Chloro-4-(methoxymethoxy)phenylboronic acid is B(C1=CC(=C(C=C1)OCOC)Cl)(O)O.

What is the CAS number of 3-Chloro-4-(methoxymethoxy)phenylboronic acid?

The CAS number of 3-Chloro-4-(methoxymethoxy)phenylboronic acid is 1451392-27-0.

What is the EC number of 3-Chloro-4-(methoxymethoxy)phenylboronic acid?

The EC number of 3-Chloro-4-(methoxymethoxy)phenylboronic acid is 832-358-6.

What is the hydrogen bond donor count of 3-Chloro-4-(methoxymethoxy)phenylboronic acid?

The hydrogen bond donor count of 3-Chloro-4-(methoxymethoxy)phenylboronic acid is 2.