CAS
128312-11-8 Purity
97%
128312-11-8 Purity
97%
Inquiry Basket
2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid
CAS
1451392-26-9
Catalog Number
ACM1451392269
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid?
The molecular formula of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid is C8H9BClFO4.
What is the molecular weight of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid?
The molecular weight of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid is 234.42 g/mol.
How is the IUPAC name of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid computed?
The IUPAC name of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid is computed by Lexichem TK 2.7.0.
What is the InChI of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid?
The InChI of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid is InChI=1S/C8H9BClFO4/c1-14-4-15-6-3-2-5(11)7(8(6)10)9(12)13/h2-3,12-13H,4H2,1H3.
What is the InChIKey of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid?
The InChIKey of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid is HEHSNQNHNZDAGM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid?
The canonical SMILES of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid is B(C1=C(C=CC(=C1Cl)OCOC)F)(O)O.
What is the CAS number of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid?
The CAS number of 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid is 1451392-26-9.
How many hydrogen bond donor counts are there in 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid?
There are 2 hydrogen bond donor counts in 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid.
How many hydrogen bond acceptor counts are there in 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid?
There are 5 hydrogen bond acceptor counts in 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid.
How many rotatable bond counts are there in 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid?
There are 4 rotatable bond counts in 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid.
Recommended Products
CAS
1451392-28-1 Purity
---
1451392-28-1 Purity
---
