CAS
--- Purity
---
--- Purity
---
Inquiry Basket
O-Bromophenoxyacetic acid
Catalog Number
ACMA00003014
Category
Imidates
Molecular Weight
231.04
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H315-H319-H335
RIDADR
UN 2811 6.1 / PGIII
Symbol
GHS07
What is the molecular formula of O-Bromophenoxyacetic acid?
The molecular formula of O-Bromophenoxyacetic acid is C8H7BrO3.
What is the molecular weight of O-Bromophenoxyacetic acid?
The molecular weight of O-Bromophenoxyacetic acid is 231.04 g/mol.
What is the IUPAC name of O-Bromophenoxyacetic acid?
The IUPAC name of O-Bromophenoxyacetic acid is 2-(2-bromophenoxy)acetic acid.
What is the InChI of O-Bromophenoxyacetic acid?
The InChI of O-Bromophenoxyacetic acid is InChI=1S/C8H7BrO3/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4H,5H2,(H,10,11).
What is the InChIKey of O-Bromophenoxyacetic acid?
The InChIKey of O-Bromophenoxyacetic acid is AZYODYPUWJPKOI-UHFFFAOYSA-N.
What is the canonical SMILES of O-Bromophenoxyacetic acid?
The canonical SMILES of O-Bromophenoxyacetic acid is C1=CC=C(C(=C1)OCC(=O)O)Br.
What is the CAS number of O-Bromophenoxyacetic acid?
The CAS number of O-Bromophenoxyacetic acid is 1879-56-7.
How many hydrogen bond donor count does O-Bromophenoxyacetic acid have?
O-Bromophenoxyacetic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does O-Bromophenoxyacetic acid have?
O-Bromophenoxyacetic acid has 3 hydrogen bond acceptor count.
Recommended Products
