2-Chloro-4-methoxybenzaldehyde

• Catalog Number: ACMA00003010
• Category: Imidates
• Molecular Weight: 170.59
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-Chloro-4-methoxybenzaldehyde?

The molecular formula of 2-Chloro-4-methoxybenzaldehyde is C8H7ClO2.

What is the molecular weight of 2-Chloro-4-methoxybenzaldehyde?

The molecular weight of 2-Chloro-4-methoxybenzaldehyde is 170.59 g/mol.

What is the IUPAC name of 2-Chloro-4-methoxybenzaldehyde?

The IUPAC name of 2-Chloro-4-methoxybenzaldehyde is 2-chloro-4-methoxybenzaldehyde.

What is the InChI of 2-Chloro-4-methoxybenzaldehyde?

The InChI of 2-Chloro-4-methoxybenzaldehyde is InChI=1S/C8H7ClO2/c1-11-7-3-2-6(5-10)8(9)4-7/h2-5H,1H3.

What is the InChIKey of 2-Chloro-4-methoxybenzaldehyde?

The InChIKey of 2-Chloro-4-methoxybenzaldehyde is YWGKOEQZKMSICW-UHFFFAOYSA-N.

What is the Canonical SMILES of 2-Chloro-4-methoxybenzaldehyde?

The Canonical SMILES of 2-Chloro-4-methoxybenzaldehyde is COC1=CC(=C(C=C1)C=O)Cl.

What is the CAS number of 2-Chloro-4-methoxybenzaldehyde?

The CAS number of 2-Chloro-4-methoxybenzaldehyde is 54439-75-7.

How many hydrogen bond donor counts are there in 2-Chloro-4-methoxybenzaldehyde?

There are 0 hydrogen bond donor counts in 2-Chloro-4-methoxybenzaldehyde.

How many hydrogen bond acceptor counts are there in 2-Chloro-4-methoxybenzaldehyde?

There are 2 hydrogen bond acceptor counts in 2-Chloro-4-methoxybenzaldehyde.