4-Bromo-3-methoxybenzoic acid

• Catalog Number: ACMA00003015
• Category: Imidates
• Molecular Weight: 231.04
• Molecular Formula: C₉H₁₁NO
• Hazard Statements: H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 4-Bromo-3-methoxybenzoic acid?

The molecular formula of 4-Bromo-3-methoxybenzoic acid is C8H7BrO3.

What is the molecular weight of 4-Bromo-3-methoxybenzoic acid?

The molecular weight of 4-Bromo-3-methoxybenzoic acid is 231.04 g/mol.

What is the IUPAC Name of 4-Bromo-3-methoxybenzoic acid?

The IUPAC Name of 4-Bromo-3-methoxybenzoic acid is 4-bromo-3-methoxybenzoic acid.

What is the InChIKey of 4-Bromo-3-methoxybenzoic acid?

The InChIKey of 4-Bromo-3-methoxybenzoic acid is UEVXVBKBOFGKIN-UHFFFAOYSA-N.

What is the Canonical SMILES of 4-Bromo-3-methoxybenzoic acid?

The Canonical SMILES of 4-Bromo-3-methoxybenzoic acid is COC1=C(C=CC(=C1)C(=O)O)Br.

What is the CAS number of 4-Bromo-3-methoxybenzoic acid?

The CAS number of 4-Bromo-3-methoxybenzoic acid is 56256-14-5.

What is the XLogP3 value of 4-Bromo-3-methoxybenzoic acid?

The XLogP3 value of 4-Bromo-3-methoxybenzoic acid is 2.5.

How many hydrogen bond acceptors does 4-Bromo-3-methoxybenzoic acid have?

4-Bromo-3-methoxybenzoic acid has 3 hydrogen bond acceptors.

What is the exact mass of 4-Bromo-3-methoxybenzoic acid?

The exact mass of 4-Bromo-3-methoxybenzoic acid is 229.95786 g/mol.

Is 4-Bromo-3-methoxybenzoic acid a canonicalized compound?

Yes, 4-Bromo-3-methoxybenzoic acid is a canonicalized compound.