CAS
--- Purity
---
--- Purity
---
Inquiry Basket
(3-Chlorophenoxy)acetic acid
Catalog Number
ACMA00003012
Category
Imidates
Molecular Weight
186.59
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H226-H302-H315-H319-H335
RIDADR
NONH for all modes of transport
Symbol
GHS02
What is the molecular formula of (3-Chlorophenoxy)acetic acid?
The molecular formula of (3-Chlorophenoxy)acetic acid is C8H7ClO3.
What is the molecular weight of (3-Chlorophenoxy)acetic acid?
The molecular weight of (3-Chlorophenoxy)acetic acid is 186.59 g/mol.
What is the IUPAC name of (3-Chlorophenoxy)acetic acid?
The IUPAC name of (3-Chlorophenoxy)acetic acid is 2-(3-chlorophenoxy)acetic acid.
What is the InChI of (3-Chlorophenoxy)acetic acid?
The InChI of (3-Chlorophenoxy)acetic acid is InChI=1S/C8H7ClO3/c9-6-2-1-3-7(4-6)12-5-8(10)11/h1-4H,5H2,(H,10,11).
What is the InChIKey of (3-Chlorophenoxy)acetic acid?
The InChIKey of (3-Chlorophenoxy)acetic acid is XSBUXVWJQVTYLC-UHFFFAOYSA-N.
What is the CAS number of (3-Chlorophenoxy)acetic acid?
The CAS number of (3-Chlorophenoxy)acetic acid is 588-32-9.
What is the molecular weight of (3-Chlorophenoxy)acetic acid calculated by PubChem?
The molecular weight of (3-Chlorophenoxy)acetic acid calculated by PubChem is 186.59 g/mol.
How many hydrogen bond donor counts are there in (3-Chlorophenoxy)acetic acid?
There is 1 hydrogen bond donor count in (3-Chlorophenoxy)acetic acid.
How many hydrogen bond acceptor counts are there in (3-Chlorophenoxy)acetic acid?
There are 3 hydrogen bond acceptor counts in (3-Chlorophenoxy)acetic acid.
How many rotatable bond counts are there in (3-Chlorophenoxy)acetic acid?
There are 3 rotatable bond counts in (3-Chlorophenoxy)acetic acid.
Recommended Products
