--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 3-(2-phenylethylamino)propanamide.
The molecular formula of the compound is C11H16N2O.
The molecular weight of the compound is 192.26 g/mol.
The InChI key of the compound is MGFDDFHJSUZRFK-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC=C(C=C1)CCNCCC(=O)N.
The CAS number of the compound is 4091-84-3.
The XLogP3-AA value of the compound is 0.6.
The compound has 2 hydrogen bond donor counts.
The compound has 6 rotatable bond counts.
Yes, the compound is canonicalized.