4-(4-Fluoro-phenoxy)-benzenesulfonyl chloride

• Catalog Number: ACMA00000929
• Category: Amines
• Molecular Weight: 286.71
• Molecular Formula: C₁₁H₁₆ClNO₂
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C12H8ClFO3S.

What is the molecular weight of the compound?

The molecular weight of the compound is 286.71 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-(4-fluorophenoxy)benzenesulfonyl chloride.

What is the InChI code of the compound?

The InChI code of the compound is InChI=1S/C12H8ClFO3S/c13-18(15,16)12-7-5-11(6-8-12)17-10-3-1-9(14)2-4-10/h1-8H.

What is the InChIKey of the compound?

The InChIKey of the compound is PDAYRCHIAPCRRD-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is C1=CC(=CC=C1OC2=CC=C(C=C2)S(=O)(=O)Cl)F.

What is the CAS number of the compound?

The CAS number of the compound is 192329-91-2.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 813-207-3.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 3.6.

Is the compound canonicalized?

Yes, the compound is canonicalized.