--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H16N2O.
The molecular weight of the compound is 192.26 g/mol.
The IUPAC name of the compound is N-[4-(aminomethyl)phenyl]-2-methylpropanamide.
The InChI code of the compound is InChI=1S/C11H16N2O/c1-8(2)11(14)13-10-5-3-9(7-12)4-6-10/h3-6,8H,7,12H2,1-2H3,(H,13,14).
The InChIKey of the compound is AFYFHAHVKBQZOZ-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(C)C(=O)NC1=CC=C(C=C1)CN.
The XLogP3 value of the compound is 0.8.
The compound has 2 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.
The compound has 3 rotatable bond counts.