--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is N-[(2-methylphenyl)methyl]propan-2-amine.
The molecular weight of the compound is 163.26 g/mol.
The InChI of the compound is InChI=1S/C11H17N/c1-9(2)12-8-11-7-5-4-6-10(11)3/h4-7,9,12H,8H2,1-3H3.
The InChIKey of the compound is UZZWRYCILDHXEC-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=CC=CC=C1CNC(C)C.
The CAS number of the compound is 91338-98-6.
The XLogP3-AA value of the compound is 2.5.
The compound has 1 hydrogen bond donor count.
The compound has 1 hydrogen bond acceptor count.
The compound has 3 rotatable bond counts.