N-[3-(Aminomethyl)phenyl]cyclobutanecarboxamide

• Catalog Number: ACMA00001012
• Category: Amines
• Molecular Weight: 204.27
• Molecular Formula: C₁₂H₁₅NO₂
• Hazard Statements: H319
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide?

The molecular formula is C12H16N2O.

What is the molecular weight of N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide?

The molecular weight is 204.27 g/mol.

What is the IUPAC name of N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide?

The IUPAC name is N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide.

What is the InChI of N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide?

The InChI is InChI=1S/C12H16N2O/c13-8-9-3-1-6-11(7-9)14-12(15)10-4-2-5-10/h1,3,6-7,10H,2,4-5,8,13H2,(H,14,15).

What is the InChIKey of N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide?

The InChIKey is MJJZKJAKJMAJNM-UHFFFAOYSA-N.

What is the canonical SMILES of N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide?

The canonical SMILES is C1CC(C1)C(=O)NC2=CC=CC(=C2)CN.

What is the XLogP3-AA value of N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide?

The XLogP3-AA value is 1.

How many hydrogen bond donor counts does N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide have?

N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide have?

N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide have?

N-[3-(aminomethyl)phenyl]cyclobutanecarboxamide has 3 rotatable bond counts.