3-(Isobutyrylamino)-4-methylbenzoic acid

• Catalog Number: ACMA00001014
• Category: Amines
• Molecular Weight: 221.25
• Molecular Formula: C₁₂H₁₅N
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3-(isobutyrylamino)-4-methylbenzoic acid?

The molecular formula of 3-(isobutyrylamino)-4-methylbenzoic acid is C12H15NO3.

What is the molecular weight of 3-(isobutyrylamino)-4-methylbenzoic acid?

The molecular weight of 3-(isobutyrylamino)-4-methylbenzoic acid is 221.25 g/mol.

What is the IUPAC name of 3-(isobutyrylamino)-4-methylbenzoic acid?

The IUPAC name of 3-(isobutyrylamino)-4-methylbenzoic acid is 4-methyl-3-(2-methylpropanoylamino)benzoic acid.

What is the InChI of 3-(isobutyrylamino)-4-methylbenzoic acid?

The InChI of 3-(isobutyrylamino)-4-methylbenzoic acid is InChI=1S/C12H15NO3/c1-7(2)11(14)13-10-6-9(12(15)16)5-4-8(10)3/h4-7H,1-3H3,(H,13,14)(H,15,16).

What is the InChIKey of 3-(isobutyrylamino)-4-methylbenzoic acid?

The InChIKey of 3-(isobutyrylamino)-4-methylbenzoic acid is ITNJBNSCALFBTK-UHFFFAOYSA-N.

What is the canonical SMILES of 3-(isobutyrylamino)-4-methylbenzoic acid?

The canonical SMILES of 3-(isobutyrylamino)-4-methylbenzoic acid is CC1=C(C=C(C=C1)C(=O)O)NC(=O)C(C)C.

What is the CAS number of 3-(isobutyrylamino)-4-methylbenzoic acid?

The CAS number of 3-(isobutyrylamino)-4-methylbenzoic acid is 915921-46-9.

What is the hydrogen bond donor count of 3-(isobutyrylamino)-4-methylbenzoic acid?

The hydrogen bond donor count of 3-(isobutyrylamino)-4-methylbenzoic acid is 2.

What is the hydrogen bond acceptor count of 3-(isobutyrylamino)-4-methylbenzoic acid?

The hydrogen bond acceptor count of 3-(isobutyrylamino)-4-methylbenzoic acid is 3.

Is 3-(isobutyrylamino)-4-methylbenzoic acid a canonicalized compound?

Yes, 3-(isobutyrylamino)-4-methylbenzoic acid is a canonicalized compound.