Methyl 3-amino-3-(2,4-dimethylphenyl)propanoate

• Catalog Number: ACMA00001009
• Category: Amines
• Molecular Weight: 207.27
• Molecular Formula: C₁₂H₁₅NO₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of methyl 3-amino-3-(2,4-dimethylphenyl)propanoate?

The molecular formula is C12H17NO2.

What is the molecular weight of methyl 3-amino-3-(2,4-dimethylphenyl)propanoate?

The molecular weight is 207.27 g/mol.

What is the IUPAC name of methyl 3-amino-3-(2,4-dimethylphenyl)propanoate?

The IUPAC name is methyl 3-amino-3-(2,4-dimethylphenyl)propanoate.

What is the InChI of methyl 3-amino-3-(2,4-dimethylphenyl)propanoate?

The InChI is InChI=1S/C12H17NO2/c1-8-4-5-10(9(2)6-8)11(13)7-12(14)15-3/h4-6,11H,7,13H2,1-3H3.

What is the InChIKey of methyl 3-amino-3-(2,4-dimethylphenyl)propanoate?

The InChIKey is DVOQYEQMVYMSJH-UHFFFAOYSA-N.

What is the canonical SMILES of methyl 3-amino-3-(2,4-dimethylphenyl)propanoate?

The canonical SMILES is CC1=CC(=C(C=C1)C(CC(=O)OC)N)C.

What is the XLogP3-AA value of methyl 3-amino-3-(2,4-dimethylphenyl)propanoate?

The XLogP3-AA value is 1.4.

How many hydrogen bond donor counts does methyl 3-amino-3-(2,4-dimethylphenyl)propanoate have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does methyl 3-amino-3-(2,4-dimethylphenyl)propanoate have?

It has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does methyl 3-amino-3-(2,4-dimethylphenyl)propanoate have?

It has 4 rotatable bond counts.