(1-Phenylcyclopentyl)methylamine

• Catalog Number: ACMA00001013
• Category: Amines
• Molecular Weight: 175.27
• Molecular Formula: C₁₂H₁₄N₂O₂
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (1-Phenylcyclopentyl)methylamine?

The molecular formula of (1-Phenylcyclopentyl)methylamine is C12H17N.

What is the molecular weight of (1-Phenylcyclopentyl)methylamine?

The molecular weight of (1-Phenylcyclopentyl)methylamine is 175.27 g/mol.

What is the IUPAC name of (1-Phenylcyclopentyl)methylamine?

The IUPAC name of (1-Phenylcyclopentyl)methylamine is (1-phenylcyclopentyl)methanamine.

What is the InChI of (1-Phenylcyclopentyl)methylamine?

The InChI of (1-Phenylcyclopentyl)methylamine is InChI=1S/C12H17N/c13-10-12(8-4-5-9-12)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10,13H2.

What is the InChIKey of (1-Phenylcyclopentyl)methylamine?

The InChIKey of (1-Phenylcyclopentyl)methylamine is SJWOFBVBNFLWLP-UHFFFAOYSA-N.

What is the canonical SMILES of (1-Phenylcyclopentyl)methylamine?

The canonical SMILES of (1-Phenylcyclopentyl)methylamine is C1CCC(C1)(CN)C2=CC=CC=C2.

What is the CAS number of (1-Phenylcyclopentyl)methylamine?

The CAS number of (1-Phenylcyclopentyl)methylamine is 17511-89-6.

What is the molecular weight calculated by PubChem?

The molecular weight of (1-Phenylcyclopentyl)methylamine is calculated as 175.27 g/mol by PubChem 2.1.

How many hydrogen bond donor counts does (1-Phenylcyclopentyl)methylamine have?

(1-Phenylcyclopentyl)methylamine has 1 hydrogen bond donor count.

How many rotatable bond counts does (1-Phenylcyclopentyl)methylamine have?

(1-Phenylcyclopentyl)methylamine has 2 rotatable bond counts.