CAS
1451393-33-1 Purity
---
1451393-33-1 Purity
---
Inquiry Basket
3-Bromo-5-isopropylphenylboronic acid
CAS
1451390-87-6
Catalog Number
ACM1451390876
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Bromo-5-isopropylphenylboronic acid?
The molecular formula of 3-Bromo-5-isopropylphenylboronic acid is C9H12BBrO2.
What is the molecular weight of 3-Bromo-5-isopropylphenylboronic acid?
The molecular weight of 3-Bromo-5-isopropylphenylboronic acid is 242.91 g/mol.
When was 3-Bromo-5-isopropylphenylboronic acid created?
3-Bromo-5-isopropylphenylboronic acid was created on March 8, 2012.
What is the IUPAC name of 3-Bromo-5-isopropylphenylboronic acid?
The IUPAC name of 3-Bromo-5-isopropylphenylboronic acid is (3-bromo-5-propan-2-ylphenyl)boronic acid.
What is the InChI of 3-Bromo-5-isopropylphenylboronic acid?
The InChI of 3-Bromo-5-isopropylphenylboronic acid is InChI=1S/C9H12BBrO2/c1-6(2)7-3-8(10(12)13)5-9(11)4-7/h3-6,12-13H,1-2H3.
What is the InChIKey of 3-Bromo-5-isopropylphenylboronic acid?
The InChIKey of 3-Bromo-5-isopropylphenylboronic acid is DNQVEISBEIMQOG-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-isopropylphenylboronic acid?
The canonical SMILES of 3-Bromo-5-isopropylphenylboronic acid is B(C1=CC(=CC(=C1)Br)C(C)C)(O)O.
How many hydrogen bond donor count does 3-Bromo-5-isopropylphenylboronic acid have?
3-Bromo-5-isopropylphenylboronic acid has 2 hydrogen bond donor count.
How many hydrogen bond acceptor count does 3-Bromo-5-isopropylphenylboronic acid have?
3-Bromo-5-isopropylphenylboronic acid has 2 hydrogen bond acceptor count.
How many rotatable bond count does 3-Bromo-5-isopropylphenylboronic acid have?
3-Bromo-5-isopropylphenylboronic acid has 2 rotatable bond count.
Recommended Products
