2-Bromo-3-trifluoromethylphenylboronic acid

• CAS: 1451393-48-8
• Catalog Number: ACM1451393488
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 2-Bromo-3-trifluoromethylphenylboronic acid?

The molecular formula of 2-Bromo-3-trifluoromethylphenylboronic acid is C7H5BBrF3O2.

What is the IUPAC name of 2-Bromo-3-trifluoromethylphenylboronic acid?

The IUPAC name of 2-Bromo-3-trifluoromethylphenylboronic acid is [2-bromo-3-(trifluoromethyl)phenyl]boronic acid.

What is the InChI of 2-Bromo-3-trifluoromethylphenylboronic acid?

The InChI of 2-Bromo-3-trifluoromethylphenylboronic acid is InChI=1S/C7H5BBrF3O2/c9-6-4(7(10,11)12)2-1-3-5(6)8(13)14/h1-3,13-14H.

What is the InChIKey of 2-Bromo-3-trifluoromethylphenylboronic acid?

The InChIKey of 2-Bromo-3-trifluoromethylphenylboronic acid is DGEDEAVZOHLRDU-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-3-trifluoromethylphenylboronic acid?

The canonical SMILES of 2-Bromo-3-trifluoromethylphenylboronic acid is B(C1=C(C(=CC=C1)C(F)(F)F)Br)(O)O.

What is the CAS number of 2-Bromo-3-trifluoromethylphenylboronic acid?

The CAS number of 2-Bromo-3-trifluoromethylphenylboronic acid is 1451393-48-8.

What is the molecular weight of 2-Bromo-3-trifluoromethylphenylboronic acid?

The molecular weight of 2-Bromo-3-trifluoromethylphenylboronic acid is 268.83 g/mol.

How many hydrogen bond donor counts does 2-Bromo-3-trifluoromethylphenylboronic acid have?

2-Bromo-3-trifluoromethylphenylboronic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-Bromo-3-trifluoromethylphenylboronic acid have?

2-Bromo-3-trifluoromethylphenylboronic acid has 5 hydrogen bond acceptor counts.

How many rotatable bond counts does 2-Bromo-3-trifluoromethylphenylboronic acid have?

2-Bromo-3-trifluoromethylphenylboronic acid has 1 rotatable bond count.