CAS
1451393-36-4 Purity
---
1451393-36-4 Purity
---
Inquiry Basket
2-Fluoro-4-(morpholinomethyl)phenylboronic acid
CAS
1451393-46-6
Catalog Number
ACM1451393466
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid?
The molecular formula of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid is C11H15BFNO3.
What are the synonyms of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid?
The synonyms of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid include 1451393-46-6, (2-fluoro-4-(morpholinomethyl)phenyl)boronic acid, [2-fluoro-4-(morpholin-4-ylmethyl)phenyl]boronic acid, and MFCD20526397.
What is the molecular weight of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid?
The molecular weight of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid is 239.05 g/mol.
What is the IUPAC name of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid?
The IUPAC name of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid is [2-fluoro-4-(morpholin-4-ylmethyl)phenyl]boronic acid.
What is the InChI of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid?
The InChI of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid is InChI=1S/C11H15BFNO3/c13-11-7-9(1-2-10(11)12(15)16)8-14-3-5-17-6-4-14/h1-2,7,15-16H,3-6,8H2.
What is the InChIKey of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid?
The InChIKey of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid is DCGZQOHKVDEKNF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid?
The canonical SMILES of 2-Fluoro-4-(morpholinomethyl)phenylboronic acid is B(C1=C(C=C(C=C1)CN2CCOCC2)F)(O)O.
How many hydrogen bond donor counts does 2-Fluoro-4-(morpholinomethyl)phenylboronic acid have?
2-Fluoro-4-(morpholinomethyl)phenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Fluoro-4-(morpholinomethyl)phenylboronic acid have?
2-Fluoro-4-(morpholinomethyl)phenylboronic acid has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does 2-Fluoro-4-(morpholinomethyl)phenylboronic acid have?
2-Fluoro-4-(morpholinomethyl)phenylboronic acid has 3 rotatable bond counts.
Recommended Products
