CAS
1451393-31-9 Purity
---
1451393-31-9 Purity
---
Inquiry Basket
3-Chloro-5-formylphenylboronic acid
CAS
1451393-35-3
Catalog Number
ACM1451393353
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Chloro-5-formylphenylboronic acid?
The molecular formula of 3-Chloro-5-formylphenylboronic acid is C7H6BClO3.
When was 3-Chloro-5-formylphenylboronic acid created?
3-Chloro-5-formylphenylboronic acid was created on June 21, 2011.
What is the IUPAC name of 3-Chloro-5-formylphenylboronic acid?
The IUPAC name of 3-Chloro-5-formylphenylboronic acid is (3-chloro-5-formylphenyl)boronic acid.
What is the InChI of 3-Chloro-5-formylphenylboronic acid?
The InChI of 3-Chloro-5-formylphenylboronic acid is InChI=1S/C7H6BClO3/c9-7-2-5(4-10)1-6(3-7)8(11)12/h1-4,11-12H.
What is the InChIKey of 3-Chloro-5-formylphenylboronic acid?
The InChIKey of 3-Chloro-5-formylphenylboronic acid is AIHAWPBOAVSYOE-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Chloro-5-formylphenylboronic acid?
The canonical SMILES of 3-Chloro-5-formylphenylboronic acid is B(C1=CC(=CC(=C1)Cl)C=O)(O)O.
What is the CAS number of 3-Chloro-5-formylphenylboronic acid?
The CAS number of 3-Chloro-5-formylphenylboronic acid is 1451393-35-3.
What is the molecular weight of 3-Chloro-5-formylphenylboronic acid?
The molecular weight of 3-Chloro-5-formylphenylboronic acid is 184.39 g/mol.
How many hydrogen bond donor counts does 3-Chloro-5-formylphenylboronic acid have?
3-Chloro-5-formylphenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Chloro-5-formylphenylboronic acid have?
3-Chloro-5-formylphenylboronic acid has 3 hydrogen bond acceptor counts.
Recommended Products
