CAS
1451393-32-0 Purity
---
1451393-32-0 Purity
---
Inquiry Basket
3,5-Dichloro-4-formylphenylboronic acid
CAS
1451393-36-4
Catalog Number
ACM1451393364
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3,5-Dichloro-4-formylphenylboronic acid?
The molecular formula is C7H5BCl2O3.
What is the molecular weight of 3,5-Dichloro-4-formylphenylboronic acid?
The molecular weight is 218.83 g/mol.
What is the IUPAC name of 3,5-Dichloro-4-formylphenylboronic acid?
The IUPAC name is (3,5-dichloro-4-formylphenyl)boronic acid.
What is the InChI of 3,5-Dichloro-4-formylphenylboronic acid?
The InChI is InChI=1S/C7H5BCl2O3/c9-6-1-4(8(12)13)2-7(10)5(6)3-11/h1-3,12-13H.
What is the InChIKey of 3,5-Dichloro-4-formylphenylboronic acid?
The InChIKey is ISQRJPAWYFKCBK-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dichloro-4-formylphenylboronic acid?
The canonical SMILES is B(C1=CC(=C(C(=C1)Cl)C=O)Cl)(O)O.
How many hydrogen bond donor count does 3,5-Dichloro-4-formylphenylboronic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor count does 3,5-Dichloro-4-formylphenylboronic acid have?
It has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 3,5-Dichloro-4-formylphenylboronic acid have?
It has 2 rotatable bond counts.
Is 3,5-Dichloro-4-formylphenylboronic acid a canonicalized compound?
Yes, it is a canonicalized compound.
Recommended Products
