Spiro[indene-1,4'-piperidine]-3-carboxylic acid

• Catalog Number: ACMA00001127
• Category: Amines
• Molecular Weight: 229.27
• Molecular Formula: C₁₄H₁₄N₂O₃
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of spi-48940809?

The molecular formula of spi-48940809 is C14H15NO2.

What is the molecular weight of spi-48940809?

The molecular weight of spi-48940809 is 229.27 g/mol.

What is the IUPAC name of spi-48940809?

The IUPAC name of spi-48940809 is spiro[indene-3,4'-piperidine]-1-carboxylic acid.

What is the InChI of spi-48940809?

The InChI of spi-48940809 is InChI=1S/C14H15NO2/c16-13(17)11-9-14(5-7-15-8-6-14)12-4-2-1-3-10(11)12/h1-4,9,15H,5-8H2,(H,16,17).

What is the InChIKey of spi-48940809?

The InChIKey of spi-48940809 is MWAYEAPVXSDUDY-UHFFFAOYSA-N.

What is the Canonical SMILES of spi-48940809?

The Canonical SMILES of spi-48940809 is C1CNCCC12C=C(C3=CC=CC=C23)C(=O)O.

What is the CAS number of spi-48940809?

The CAS number of spi-48940809 is 936138-15-7.

What is the XLogP3-AA value of spi-48940809?

The XLogP3-AA value of spi-48940809 is -0.5.

What is the hydrogen bond donor count of spi-48940809?

The hydrogen bond donor count of spi-48940809 is 2.

What is the hydrogen bond acceptor count of spi-48940809?

The hydrogen bond acceptor count of spi-48940809 is 3.