CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2-(4-Methylphenoxy)benzylamine hydrochloride
Catalog Number
ACMA00001124
Category
Amines
Molecular Weight
249.74
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H315-H319-H335
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 2-(4-Methylphenoxy)benzylamine hydrochloride?
The molecular formula of 2-(4-Methylphenoxy)benzylamine hydrochloride is C14H16ClNO.
What is the molecular weight of 2-(4-Methylphenoxy)benzylamine hydrochloride?
The molecular weight of 2-(4-Methylphenoxy)benzylamine hydrochloride is 249.73 g/mol.
What is the IUPAC name of 2-(4-Methylphenoxy)benzylamine hydrochloride?
The IUPAC name of 2-(4-Methylphenoxy)benzylamine hydrochloride is [2-(4-methylphenoxy)phenyl]methanamine;hydrochloride.
What is the InChI of 2-(4-Methylphenoxy)benzylamine hydrochloride?
The InChI of 2-(4-Methylphenoxy)benzylamine hydrochloride is InChI=1S/C14H15NO.ClH/c1-11-6-8-13(9-7-11)16-14-5-3-2-4-12(14)10-15;/h2-9H,10,15H2,1H3;1H.
What is the InChIKey of 2-(4-Methylphenoxy)benzylamine hydrochloride?
The InChIKey of 2-(4-Methylphenoxy)benzylamine hydrochloride is XMVXIOJPNLJZRD-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(4-Methylphenoxy)benzylamine hydrochloride?
The canonical SMILES of 2-(4-Methylphenoxy)benzylamine hydrochloride is CC1=CC=C(C=C1)OC2=CC=CC=C2CN.Cl.
What is the hydrogen bond donor count of 2-(4-Methylphenoxy)benzylamine hydrochloride?
The hydrogen bond donor count of 2-(4-Methylphenoxy)benzylamine hydrochloride is 2.
What is the hydrogen bond acceptor count of 2-(4-Methylphenoxy)benzylamine hydrochloride?
The hydrogen bond acceptor count of 2-(4-Methylphenoxy)benzylamine hydrochloride is 2.
What is the rotatable bond count of 2-(4-Methylphenoxy)benzylamine hydrochloride?
The rotatable bond count of 2-(4-Methylphenoxy)benzylamine hydrochloride is 3.
Is 2-(4-Methylphenoxy)benzylamine hydrochloride a canonicalized compound?
Yes, 2-(4-Methylphenoxy)benzylamine hydrochloride is a canonicalized compound.
Recommended Products
