(4-Methylphenyl)(phenyl)methylamine

• Catalog Number: ACMA00001128
• Category: Amines
• Molecular Weight: 197.28
• Molecular Formula: C₁₄H₁₄ClNO
• Hazard Statements: H302-H319-H410
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C14H15N.

What is the molecular weight of the compound?

The molecular weight is 197.27 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is (4-methylphenyl)-phenylmethanamine.

What is the InChI of the compound?

The InChI is InChI=1S/C14H15N/c1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12/h2-10,14H,15H2,1H3.

What is the InChIKey of the compound?

The InChIKey is UHPQFNXOFFPHJW-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is CC1=CC=C(C=C1)C(C2=CC=CC=C2)N.

What is the CAS number of the compound?

The CAS number is 55095-21-1.

What is the XLogP3 value of the compound?

The XLogP3 value is 2.9.

How many rotatable bonds does the compound have?

The compound has 2 rotatable bonds.

Is the compound canonicalized?

Yes, the compound is canonicalized.