What is the molecular formula of 6-Bromo-2-cyclopropylquinoline-4-carboxylic acid?
The molecular formula is C13H10BrNO2.
What is the molecular weight of 6-Bromo-2-cyclopropylquinoline-4-carboxylic acid?
The molecular weight is 292.13 g/mol.
What is the IUPAC name of 6-Bromo-2-cyclopropylquinoline-4-carboxylic acid?
The IUPAC name is 6-bromo-2-cyclopropylquinoline-4-carboxylic acid.
What is the InChI of 6-Bromo-2-cyclopropylquinoline-4-carboxylic acid?
The InChI is InChI=1S/C13H10BrNO2/c14-8-3-4-11-9(5-8)10(13(16)17)6-12(15-11)7-1-2-7/h3-7H,1-2H2,(H,16,17).
What is the InChIKey of 6-Bromo-2-cyclopropylquinoline-4-carboxylic acid?
The InChIKey is CPGMJISXVAOPHO-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-2-cyclopropylquinoline-4-carboxylic acid?
The canonical SMILES is C1CC1C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)O.
What is the CAS number of 6-Bromo-2-cyclopropylquinoline-4-carboxylic acid?
The CAS number is 313241-16-6.
What is the DSSTox Substance ID of 6-Bromo-2-cyclopropylquinoline-4-carboxylic acid?
The DSSTox Substance ID is DTXSID00298389.
What is the NSC number of 6-Bromo-2-cyclopropylquinoline-4-carboxylic acid?
The NSC number is 122848.
Is 6-Bromo-2-cyclopropylquinoline-4-carboxylic acid a canonicalized compound?
Yes, it is a canonicalized compound.