1-(3-Bromophenyl)piperazine

• CAS: 31197-30-5
• Catalog Number: ACM31197305
• Category: Bromine Series
• Molecular Weight: 241.12
• Molecular Formula: C₁₀H₁₃BrN₂

Custom Q&A

What is the molecular formula of 1-(3-Bromophenyl)piperazine?

The molecular formula is C10H13BrN2.

What is the molecular weight of 1-(3-Bromophenyl)piperazine?

The molecular weight is 241.13 g/mol.

What is the IUPAC name of 1-(3-Bromophenyl)piperazine?

The IUPAC name is 1-(3-bromophenyl)piperazine.

What is the InChI of 1-(3-Bromophenyl)piperazine?

The InChI is InChI=1S/C10H13BrN2/c11-9-2-1-3-10(8-9)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2.

What is the InChIKey of 1-(3-Bromophenyl)piperazine?

The InChIKey is DOYNABJKDZARLF-UHFFFAOYSA-N.

What is the canonical SMILES of 1-(3-Bromophenyl)piperazine?

The canonical SMILES is C1CN(CCN1)C2=CC(=CC=C2)Br.

What is the CAS number of 1-(3-Bromophenyl)piperazine?

The CAS number is 31197-30-5.

What is the European Community (EC) number of 1-(3-Bromophenyl)piperazine?

The European Community (EC) number is 673-029-5.

What is the DSSTox Substance ID of 1-(3-Bromophenyl)piperazine?

The DSSTox Substance ID is DTXSID40953283.

Is 1-(3-Bromophenyl)piperazine a canonicalized compound?

Yes, it is a canonicalized compound.