CAS
313241-16-6 Purity
---
313241-16-6 Purity
---
Inquiry Basket
4-Bromo-2,5-dimethoxybenzaldehyde
CAS
31558-41-5
Catalog Number
ACM31558415
Category
Bromine Series
Molecular Weight
245.08
Molecular Formula
C9H9BrO3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Bromo-2,5-dimethoxybenzaldehyde?
The molecular formula of 4-Bromo-2,5-dimethoxybenzaldehyde is C9H9BrO3.
What is the molecular weight of 4-Bromo-2,5-dimethoxybenzaldehyde?
The molecular weight of 4-Bromo-2,5-dimethoxybenzaldehyde is 245.07 g/mol.
What is the IUPAC name of 4-Bromo-2,5-dimethoxybenzaldehyde?
The IUPAC name of 4-Bromo-2,5-dimethoxybenzaldehyde is 4-bromo-2,5-dimethoxybenzaldehyde.
What is the InChI of 4-Bromo-2,5-dimethoxybenzaldehyde?
The InChI of 4-Bromo-2,5-dimethoxybenzaldehyde is InChI=1S/C9H9BrO3/c1-12-8-4-7(10)9(13-2)3-6(8)5-11/h3-5H,1-2H3.
What is the InChIKey of 4-Bromo-2,5-dimethoxybenzaldehyde?
The InChIKey of 4-Bromo-2,5-dimethoxybenzaldehyde is BIFWGDWGCZLCHF-UHFFFAOYSA-N.
What is the canonical SMILES representation of 4-Bromo-2,5-dimethoxybenzaldehyde?
The canonical SMILES representation of 4-Bromo-2,5-dimethoxybenzaldehyde is COC1=CC(=C(C=C1C=O)OC)Br.
What is the CAS number of 4-Bromo-2,5-dimethoxybenzaldehyde?
The CAS number of 4-Bromo-2,5-dimethoxybenzaldehyde is 31558-41-5.
What is the XLogP3-AA value of 4-Bromo-2,5-dimethoxybenzaldehyde?
The XLogP3-AA value of 4-Bromo-2,5-dimethoxybenzaldehyde is 2.
How many hydrogen bond donors are there in 4-Bromo-2,5-dimethoxybenzaldehyde?
There are 0 hydrogen bond donors in 4-Bromo-2,5-dimethoxybenzaldehyde.
How many hydrogen bond acceptors are there in 4-Bromo-2,5-dimethoxybenzaldehyde?
There are 3 hydrogen bond acceptors in 4-Bromo-2,5-dimethoxybenzaldehyde.
Recommended Products
