CAS
31181-82-5 Purity
---
31181-82-5 Purity
---
Inquiry Basket
2-Amino-6-bromo-4-methoxybenzoic acid
CAS
1378873-30-3
Catalog Number
ACM1378873303
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Amino-6-bromo-4-methoxybenzoic acid?
The molecular formula of 2-Amino-6-bromo-4-methoxybenzoic acid is C8H8BrNO3.
What is the molecular weight of 2-Amino-6-bromo-4-methoxybenzoic acid?
The molecular weight of 2-Amino-6-bromo-4-methoxybenzoic acid is 246.06 g/mol.
What is the IUPAC name of 2-Amino-6-bromo-4-methoxybenzoic acid?
The IUPAC name of 2-Amino-6-bromo-4-methoxybenzoic acid is 2-amino-6-bromo-4-methoxybenzoic acid.
What is the InChI of 2-Amino-6-bromo-4-methoxybenzoic acid?
The InChI of 2-Amino-6-bromo-4-methoxybenzoic acid is InChI=1S/C8H8BrNO3/c1-13-4-2-5(9)7(8(11)12)6(10)3-4/h2-3H,10H2,1H3,(H,11,12).
What is the InChIKey of 2-Amino-6-bromo-4-methoxybenzoic acid?
The InChIKey of 2-Amino-6-bromo-4-methoxybenzoic acid is JNQFNEUXEYCXLK-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-6-bromo-4-methoxybenzoic acid?
The canonical SMILES of 2-Amino-6-bromo-4-methoxybenzoic acid is COC1=CC(=C(C(=C1)Br)C(=O)O)N.
What is the CAS number of 2-Amino-6-bromo-4-methoxybenzoic acid?
The CAS number of 2-Amino-6-bromo-4-methoxybenzoic acid is 1378873-30-3.
What is the XLogP3-AA value of 2-Amino-6-bromo-4-methoxybenzoic acid?
The XLogP3-AA value of 2-Amino-6-bromo-4-methoxybenzoic acid is 2.
What is the hydrogen bond donor count of 2-Amino-6-bromo-4-methoxybenzoic acid?
The hydrogen bond donor count of 2-Amino-6-bromo-4-methoxybenzoic acid is 2.
What is the hydrogen bond acceptor count of 2-Amino-6-bromo-4-methoxybenzoic acid?
The hydrogen bond acceptor count of 2-Amino-6-bromo-4-methoxybenzoic acid is 4.
Recommended Products
