2-N,N-Diethylsulfamoylphenylboronic acid

• CAS: 957061-16-4
• Catalog Number: ACM957061164
• Category: Other Products; Boronic Acids
• Molecular Formula: C₁₀H₁₆BNO₄S

Custom Q&A

What is the molecular formula of 2-N,N-diethylsulfamoylphenylboronic acid?

The molecular formula of 2-N,N-diethylsulfamoylphenylboronic acid is C10H16BNO4S.

What is the molecular weight of 2-N,N-diethylsulfamoylphenylboronic acid?

The molecular weight of 2-N,N-diethylsulfamoylphenylboronic acid is 257.12 g/mol.

When was 2-N,N-diethylsulfamoylphenylboronic acid created?

2-N,N-diethylsulfamoylphenylboronic acid was created on January 26, 2010.

What is the IUPAC name of 2-N,N-diethylsulfamoylphenylboronic acid?

The IUPAC name of 2-N,N-diethylsulfamoylphenylboronic acid is [2-(diethylsulfamoyl)phenyl]boronic acid.

What is the InChI of 2-N,N-diethylsulfamoylphenylboronic acid?

The InChI of 2-N,N-diethylsulfamoylphenylboronic acid is InChI=1S/C10H16BNO4S/c1-3-12(4-2)17(15,16)10-8-6-5-7-9(10)11(13)14/h5-8,13-14H,3-4H2,1-2H3.

What is the InChIKey of 2-N,N-diethylsulfamoylphenylboronic acid?

The InChIKey of 2-N,N-diethylsulfamoylphenylboronic acid is DJGWUWODZFKVIY-UHFFFAOYSA-N.

What is the canonical SMILES of 2-N,N-diethylsulfamoylphenylboronic acid?

The canonical SMILES of 2-N,N-diethylsulfamoylphenylboronic acid is B(C1=CC=CC=C1S(=O)(=O)N(CC)CC)(O)O.

How many hydrogen bond donor counts does 2-N,N-diethylsulfamoylphenylboronic acid have?

2-N,N-diethylsulfamoylphenylboronic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-N,N-diethylsulfamoylphenylboronic acid have?

2-N,N-diethylsulfamoylphenylboronic acid has 5 hydrogen bond acceptor counts.

What is the topological polar surface area of 2-N,N-diethylsulfamoylphenylboronic acid?

The topological polar surface area of 2-N,N-diethylsulfamoylphenylboronic acid is 86.2Ų.