5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid

• CAS: 957062-53-2
• Catalog Number: ACM957062532
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid?

The molecular formula of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid is C10H13BO5.

When was 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid created and last modified?

5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid was created on July 21, 2009, and last modified on December 2, 2023.

What is the IUPAC name of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid?

The IUPAC name of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid is (5-ethoxycarbonyl-2-methoxyphenyl)boronic acid.

What is the InChI of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid?

The InChI of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid is InChI=1S/C10H13BO5/c1-3-16-10(12)7-4-5-9(15-2)8(6-7)11(13)14/h4-6,13-14H,3H2,1-2H3.

What is the InChIKey of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid?

The InChIKey of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid is NNQFBMDJWJUGQO-UHFFFAOYSA-N.

How many hydrogen bond donor counts does 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid have?

5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid has 2 hydrogen bond donor counts.

What is the topological polar surface area of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid?

The topological polar surface area of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid is 76Ų.

How many rotatable bond counts does 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid have?

5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid has 5 rotatable bond counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.

What is the molecular weight of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid?

The molecular weight of 5-(Ethoxycarbonyl)-2-methoxyphenylboronic acid is 224.02 g/mol.