What is the molecular formula of 2-Bromo-6-chloro-3-methoxyphenylboronic acid?
The molecular formula is C7H7BBrClO3.
What is the molecular weight of 2-Bromo-6-chloro-3-methoxyphenylboronic acid?
The molecular weight is 265.30 g/mol.
When was 2-Bromo-6-chloro-3-methoxyphenylboronic acid created?
It was created on July 21, 2009.
When was 2-Bromo-6-chloro-3-methoxyphenylboronic acid last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 2-Bromo-6-chloro-3-methoxyphenylboronic acid?
The IUPAC name is (2-bromo-6-chloro-3-methoxyphenyl)boronic acid.
What is the InChI of 2-Bromo-6-chloro-3-methoxyphenylboronic acid?
The InChI is InChI=1S/C7H7BBrClO3/c1-13-5-3-2-4(10)6(7(5)9)8(11)12/h2-3,11-12H,1H3.
What is the InChIKey of 2-Bromo-6-chloro-3-methoxyphenylboronic acid?
The InChIKey is PEEJEHWBRGQIAD-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-6-chloro-3-methoxyphenylboronic acid?
The canonical SMILES is B(C1=C(C=CC(=C1Br)OC)Cl)(O)O.
What is the CAS number of 2-Bromo-6-chloro-3-methoxyphenylboronic acid?
The CAS number is 957062-90-7.
What is the molecular weight and complexity of 2-Bromo-6-chloro-3-methoxyphenylboronic acid?
The molecular weight is 265.30 g/mol, and the complexity is 172.