CAS
957061-05-1 Purity
98%
957061-05-1 Purity
98%
Inquiry Basket
2-Ethoxycabonyl-5-fluorophenylboronic acid
CAS
957062-87-2
Catalog Number
ACM957062872
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Ethoxycabonyl-5-fluorophenylboronic acid?
The molecular formula of 2-Ethoxycabonyl-5-fluorophenylboronic acid is C9H10BFO4.
What is the molecular weight of 2-Ethoxycabonyl-5-fluorophenylboronic acid?
The molecular weight of 2-Ethoxycabonyl-5-fluorophenylboronic acid is 211.98 g/mol.
What is the IUPAC name of 2-Ethoxycabonyl-5-fluorophenylboronic acid?
The IUPAC name of 2-Ethoxycabonyl-5-fluorophenylboronic acid is (2-ethoxycarbonyl-5-fluorophenyl)boronic acid.
What is the InChI of 2-Ethoxycabonyl-5-fluorophenylboronic acid?
The InChI of 2-Ethoxycabonyl-5-fluorophenylboronic acid is InChI=1S/C9H10BFO4/c1-2-15-9(12)7-4-3-6(11)5-8(7)10(13)14/h3-5,13-14H,2H2,1H3.
What is the InChIKey of 2-Ethoxycabonyl-5-fluorophenylboronic acid?
The InChIKey of 2-Ethoxycabonyl-5-fluorophenylboronic acid is DIHBRMAJVXAIOE-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Ethoxycabonyl-5-fluorophenylboronic acid?
The canonical SMILES of 2-Ethoxycabonyl-5-fluorophenylboronic acid is B(C1=C(C=CC(=C1)F)C(=O)OCC)(O)O.
What is the CAS number of 2-Ethoxycabonyl-5-fluorophenylboronic acid?
The CAS number of 2-Ethoxycabonyl-5-fluorophenylboronic acid is 957062-87-2.
How many hydrogen bond donor counts are there in 2-Ethoxycabonyl-5-fluorophenylboronic acid?
There are 2 hydrogen bond donor counts in 2-Ethoxycabonyl-5-fluorophenylboronic acid.
How many hydrogen bond acceptor counts are there in 2-Ethoxycabonyl-5-fluorophenylboronic acid?
There are 5 hydrogen bond acceptor counts in 2-Ethoxycabonyl-5-fluorophenylboronic acid.
How many rotatable bond counts are there in 2-Ethoxycabonyl-5-fluorophenylboronic acid?
There are 4 rotatable bond counts in 2-Ethoxycabonyl-5-fluorophenylboronic acid.
Recommended Products
