(5-Bromopyridin-2-yl)methanol hydrochloride

• CAS: 31181-82-5
• Catalog Number: ACM31181825
• Category: Bromine Series
• Molecular Formula: C₆H₆BrNO.HCl
• Synonyms: 5-Bromo-2-pyridinemethanol hydrochloride;(5-Bromopyridin-2-yl)methanol hydrochloride

Custom Q&A

What is the PubChem CID for (5-Bromopyridin-2-yl)methanol hydrochloride?

The PubChem CID is 60146013.

What is the molecular formula of (5-Bromopyridin-2-yl)methanol hydrochloride?

The molecular formula is C6H7BrClNO.

What is the molecular weight of (5-Bromopyridin-2-yl)methanol hydrochloride?

The molecular weight is 224.48 g/mol.

What is the IUPAC name of (5-Bromopyridin-2-yl)methanol hydrochloride?

The IUPAC name is (5-bromopyridin-2-yl)methanol;hydrochloride.

What is the InChI of (5-Bromopyridin-2-yl)methanol hydrochloride?

The InChI is InChI=1S/C6H6BrNO.ClH/c7-5-1-2-6(4-9)8-3-5;/h1-3,9H,4H2;1H.

What is the InChIKey of (5-Bromopyridin-2-yl)methanol hydrochloride?

The InChIKey is XLFUBEIWXFHWHJ-UHFFFAOYSA-N.

What is the canonical SMILES of (5-Bromopyridin-2-yl)methanol hydrochloride?

The canonical SMILES is C1=CC(=NC=C1Br)CO.Cl.

What is the CAS number of (5-Bromopyridin-2-yl)methanol hydrochloride?

The CAS number is 31181-82-5.

What is the hydrogen bond donor count of (5-Bromopyridin-2-yl)methanol hydrochloride?

The hydrogen bond donor count is 2.

Is (5-Bromopyridin-2-yl)methanol hydrochloride a canonicalized compound?

Yes, (5-Bromopyridin-2-yl)methanol hydrochloride is a canonicalized compound.