N-Ethylbutan-2-amine hydrochloride

• Catalog Number: ACMA00000755
• Category: Amine Salts
• Molecular Weight: 137.65
• Molecular Formula: C₆H₁₄ClN
• Hazard Statements: H302-H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of N-Ethylbutan-2-amine hydrochloride?

The molecular formula is C6H16ClN.

What is the molecular weight of N-Ethylbutan-2-amine hydrochloride?

The molecular weight is 137.65 g/mol.

What is the IUPAC name of N-Ethylbutan-2-amine hydrochloride?

The IUPAC name is N-ethylbutan-2-amine;hydrochloride.

What is the InChI of N-Ethylbutan-2-amine hydrochloride?

The InChI is InChI=1S/C6H15N.ClH/c1-4-6(3)7-5-2;/h6-7H,4-5H2,1-3H3;1H.

What is the InChIKey of N-Ethylbutan-2-amine hydrochloride?

The InChIKey is PMIDEDMVPGAHQP-UHFFFAOYSA-N.

What is the canonical SMILES of N-Ethylbutan-2-amine hydrochloride?

The canonical SMILES is CCC(C)NCC.Cl.

What is the hydrogen bond donor count of N-Ethylbutan-2-amine hydrochloride?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of N-Ethylbutan-2-amine hydrochloride?

The hydrogen bond acceptor count is 1.

How many rotatable bonds does N-Ethylbutan-2-amine hydrochloride have?

N-Ethylbutan-2-amine hydrochloride has 3 rotatable bonds.

What is the topological polar surface area of N-Ethylbutan-2-amine hydrochloride?

The topological polar surface area is 12Ų.