(2,4-Dichloro-3-methylphenyl)amine hydrochloride

• Catalog Number: ACMA00000752
• Category: Amine Salts
• Molecular Weight: 212.50
• Molecular Formula: C₆H₁₆ClN
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (2,4-Dichloro-3-methylphenyl)amine hydrochloride?

The molecular formula of (2,4-Dichloro-3-methylphenyl)amine hydrochloride is C7H8Cl3N.

What are the synonyms for (2,4-Dichloro-3-methylphenyl)amine hydrochloride?

The synonyms for (2,4-Dichloro-3-methylphenyl)amine hydrochloride are 2,4-dichloro-3-methylaniline;hydrochloride and 2,4-dichloro-3-methylaniline hydrochloride.

What is the molecular weight of (2,4-Dichloro-3-methylphenyl)amine hydrochloride?

The molecular weight of (2,4-Dichloro-3-methylphenyl)amine hydrochloride is 212.5 g/mol.

What is the IUPAC name of (2,4-Dichloro-3-methylphenyl)amine hydrochloride?

The IUPAC name of (2,4-Dichloro-3-methylphenyl)amine hydrochloride is 2,4-dichloro-3-methylaniline;hydrochloride.

What is the InChI of (2,4-Dichloro-3-methylphenyl)amine hydrochloride?

The InChI of (2,4-Dichloro-3-methylphenyl)amine hydrochloride is InChI=1S/C7H7Cl2N.ClH/c1-4-5(8)2-3-6(10)7(4)9;/h2-3H,10H2,1H3;1H.

What is the InChIKey of (2,4-Dichloro-3-methylphenyl)amine hydrochloride?

The InChIKey of (2,4-Dichloro-3-methylphenyl)amine hydrochloride is IVGZBIIHDPPDST-UHFFFAOYSA-N.

What is the canonical SMILES of (2,4-Dichloro-3-methylphenyl)amine hydrochloride?

The canonical SMILES of (2,4-Dichloro-3-methylphenyl)amine hydrochloride is CC1=C(C=CC(=C1Cl)N)Cl.Cl.

How many hydrogen bond donor counts does (2,4-Dichloro-3-methylphenyl)amine hydrochloride have?

(2,4-Dichloro-3-methylphenyl)amine hydrochloride has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does (2,4-Dichloro-3-methylphenyl)amine hydrochloride have?

(2,4-Dichloro-3-methylphenyl)amine hydrochloride has 1 hydrogen bond acceptor count.

How many rotatable bond counts does (2,4-Dichloro-3-methylphenyl)amine hydrochloride have?

(2,4-Dichloro-3-methylphenyl)amine hydrochloride has 0 rotatable bond counts.