(1,2-Dimethylpropyl)methylamine hydrochloride

• Catalog Number: ACMA00000757
• Category: Amine Salts
• Molecular Weight: 137.65
• Molecular Formula: C₆H₁₀F₃N ¡¤ HC
• Hazard Statements: H300-H314-H351
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of (1,2-Dimethylpropyl)methylamine hydrochloride?

The molecular formula is C6H16ClN.

What are the synonyms of (1,2-Dimethylpropyl)methylamine hydrochloride?

The synonyms are N,3-dimethylbutan-2-amine hydrochloride, N,3-dimethylbutan-2-amine;hydrochloride, and METHYL(3-METHYLBUTAN-2-YL)AMINE HYDROCHLORIDE.

What is the molecular weight of (1,2-Dimethylpropyl)methylamine hydrochloride?

The molecular weight is 137.65 g/mol.

What is the IUPAC name of (1,2-Dimethylpropyl)methylamine hydrochloride?

The IUPAC name is N,3-dimethylbutan-2-amine;hydrochloride.

What is the InChI of (1,2-Dimethylpropyl)methylamine hydrochloride?

The InChI is InChI=1S/C6H15N.ClH/c1-5(2)6(3)7-4;/h5-7H,1-4H3;1H.

What is the InChIKey of (1,2-Dimethylpropyl)methylamine hydrochloride?

The InChIKey is APSFIFPEPAHXGT-UHFFFAOYSA-N.

What is the canonical SMILES of (1,2-Dimethylpropyl)methylamine hydrochloride?

The canonical SMILES is CC(C)C(C)NC.Cl.

What is the hydrogen bond donor count of (1,2-Dimethylpropyl)methylamine hydrochloride?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of (1,2-Dimethylpropyl)methylamine hydrochloride?

The hydrogen bond acceptor count is 1.

What is the rotatable bond count of (1,2-Dimethylpropyl)methylamine hydrochloride?

The rotatable bond count is 2.