3-(N-Benzyl-N-methylamino)-1,2-propanediol

• Catalog Number: ACMA00000921
• Category: Amines
• Molecular Weight: 195.26
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C11H17NO2.

What are the synonyms of the compound?

The synonyms of the compound are 60278-98-0, 3-(N-Benzyl-N-methylamino)-1,2-propanediol, 3-(Benzyl(methyl)amino)propane-1,2-diol, 3-[benzyl(methyl)amino]propane-1,2-diol.

What is the molecular weight of the compound?

The molecular weight of the compound is 195.26 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-[benzyl(methyl)amino]propane-1,2-diol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H17NO2/c1-12(8-11(14)9-13)7-10-5-3-2-4-6-10/h2-6,11,13-14H,7-9H2,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is HGPHYOVGIFFHJB-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CN(CC1=CC=CC=C1)CC(CO)O.

What is the CAS number of the compound?

The CAS number of the compound is 60278-98-0.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 0.5.

Is the compound canonicalized?

Yes, the compound is canonicalized.