Benzyl-N-methyl-L-alanine

• Catalog Number: ACMA00000944
• Category: Amines
• Molecular Weight: 193.24
• Molecular Formula: C₁₁H₁₅ClN₂O
• Hazard Statements: H302-H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of Benzyl-N-methyl-L-alanine?

The molecular formula of Benzyl-N-methyl-L-alanine is C11H15NO2.

What is the molecular weight of Benzyl-N-methyl-L-alanine?

The molecular weight of Benzyl-N-methyl-L-alanine is 193.24 g/mol.

What is the IUPAC name of Benzyl-N-methyl-L-alanine?

The IUPAC name of Benzyl-N-methyl-L-alanine is (2S)-2-[benzyl(methyl)amino]propanoic acid.

What is the InChI of Benzyl-N-methyl-L-alanine?

The InChI of Benzyl-N-methyl-L-alanine is InChI=1S/C11H15NO2/c1-9(11(13)14)12(2)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,13,14)/t9-/m0/s1.

What is the InChIKey of Benzyl-N-methyl-L-alanine?

The InChIKey of Benzyl-N-methyl-L-alanine is YEJHUOTUSORYPX-VIFPVBQESA-N.

What is the CAS number of Benzyl-N-methyl-L-alanine?

The CAS number of Benzyl-N-methyl-L-alanine is 63238-82-4.

What is the EC number of Benzyl-N-methyl-L-alanine?

The EC number of Benzyl-N-methyl-L-alanine is 815-214-7.

What is the XLogP3-AA value of Benzyl-N-methyl-L-alanine?

The XLogP3-AA value of Benzyl-N-methyl-L-alanine is -0.5.

How many hydrogen bond donor counts does Benzyl-N-methyl-L-alanine have?

Benzyl-N-methyl-L-alanine has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does Benzyl-N-methyl-L-alanine have?

Benzyl-N-methyl-L-alanine has 3 hydrogen bond acceptor counts.