4-tert-Butylthiobenzamide

• Catalog Number: ACMA00000942
• Category: Amines
• Molecular Weight: 193.31
• Molecular Formula: C₁₁H₁₅N
• Hazard Statements: H302-H315-H319-H335-H411
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-tert-butylbenzenecarbothioamide.

What is the molecular formula of the compound?

The molecular formula of the compound is C11H15NS.

What is the molecular weight of the compound?

The molecular weight of the compound is 193.31 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H15NS/c1-11(2,3)9-6-4-8(5-7-9)10(12)13/h4-7H,1-3H3,(H2,12,13).

What is the InChIKey of the compound?

The InChIKey of the compound is HZODWYBXBKXJLB-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC(C)(C)C1=CC=C(C=C1)C(=S)N.

What is the CAS number of the compound?

The CAS number of the compound is 57774-77-3.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 674-679-2.

What is the DSSTox Substance ID of the compound?

The DSSTox Substance ID of the compound is DTXSID40370517.

Is the compound canonicalized?

Yes, the compound is canonicalized.