3-Amino-5-phenyl-pentanoic acid

• Catalog Number: ACMA00000946
• Category: Amines
• Molecular Weight: 193.24
• Molecular Formula: C₁₁H₁₅ClN₂O₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3-Amino-5-phenyl-pentanoic acid?

The molecular formula of 3-Amino-5-phenyl-pentanoic acid is C11H15NO2.

What is the molecular weight of 3-Amino-5-phenyl-pentanoic acid?

The molecular weight of 3-Amino-5-phenyl-pentanoic acid is 193.24 g/mol.

What is the IUPAC Name of 3-Amino-5-phenyl-pentanoic acid?

The IUPAC Name of 3-Amino-5-phenyl-pentanoic acid is 3-amino-5-phenylpentanoic acid.

What is the InChI of 3-Amino-5-phenyl-pentanoic acid?

The InChI of 3-Amino-5-phenyl-pentanoic acid is InChI=1S/C11H15NO2/c12-10(8-11(13)14)7-6-9-4-2-1-3-5-9/h1-5,10H,6-8,12H2,(H,13,14).

What is the InChIKey of 3-Amino-5-phenyl-pentanoic acid?

The InChIKey of 3-Amino-5-phenyl-pentanoic acid is CJJYCYZKUNRKFP-UHFFFAOYSA-N.

What is the Canonical SMILES of 3-Amino-5-phenyl-pentanoic acid?

The Canonical SMILES of 3-Amino-5-phenyl-pentanoic acid is C1=CC=C(C=C1)CCC(CC(=O)O)N.

What is the CAS number of 3-Amino-5-phenyl-pentanoic acid?

The CAS number of 3-Amino-5-phenyl-pentanoic acid is 91247-38-0.

What is the XLogP3-AA of 3-Amino-5-phenyl-pentanoic acid?

The XLogP3-AA of 3-Amino-5-phenyl-pentanoic acid is -1.1.

How many hydrogen bond donor count does 3-Amino-5-phenyl-pentanoic acid have?

3-Amino-5-phenyl-pentanoic acid has 2 hydrogen bond donor count.

How many rotatable bond count does 3-Amino-5-phenyl-pentanoic acid have?

3-Amino-5-phenyl-pentanoic acid has 5 rotatable bond count.