CAS
767-69-1 Purity
---
767-69-1 Purity
---
Inquiry Basket
6-Bromoquinazoline-4-carboxylic acid
CAS
769916-07-6
Catalog Number
ACM769916076
Category
Bromine Series
Molecular Weight
253.05
Molecular Formula
C9H5 Br N2 O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
6-bromoquinazoline-4-carboxylic acid
What is the molecular formula of 6-Bromoquinazoline-4-carboxylic acid?
The molecular formula of 6-Bromoquinazoline-4-carboxylic acid is C9H5BrN2O2.
What is the molecular weight of 6-Bromoquinazoline-4-carboxylic acid?
The molecular weight of 6-Bromoquinazoline-4-carboxylic acid is 253.05 g/mol.
What is the IUPAC name of 6-Bromoquinazoline-4-carboxylic acid?
The IUPAC name of 6-Bromoquinazoline-4-carboxylic acid is 6-bromoquinazoline-4-carboxylic acid.
What is the InChI of 6-Bromoquinazoline-4-carboxylic acid?
The InChI of 6-Bromoquinazoline-4-carboxylic acid is InChI=1S/C9H5BrN2O2/c10-5-1-2-7-6(3-5)8(9(13)14)12-4-11-7/h1-4H,(H,13,14).
What is the InChIKey of 6-Bromoquinazoline-4-carboxylic acid?
The InChIKey of 6-Bromoquinazoline-4-carboxylic acid is KTYXRDCYHWITRG-UHFFFAOYSA-N.
What is the Canonical SMILES of 6-Bromoquinazoline-4-carboxylic acid?
The Canonical SMILES of 6-Bromoquinazoline-4-carboxylic acid is C1=CC2=C(C=C1Br)C(=NC=N2)C(=O)O.
What is the CAS number of 6-Bromoquinazoline-4-carboxylic acid?
The CAS number of 6-Bromoquinazoline-4-carboxylic acid is 769916-07-6.
How many hydrogen bond donors are there in 6-Bromoquinazoline-4-carboxylic acid?
There is 1 hydrogen bond donor in 6-Bromoquinazoline-4-carboxylic acid.
How many hydrogen bond acceptors are there in 6-Bromoquinazoline-4-carboxylic acid?
There are 4 hydrogen bond acceptors in 6-Bromoquinazoline-4-carboxylic acid.
Recommended Products
