What is the molecular formula of 2-Bromo-4-(trifluoromethoxy)-6-nitroaniline?
The molecular formula is C7H4BrF3N2O3.
What is the molecular weight of 2-Bromo-4-(trifluoromethoxy)-6-nitroaniline?
The molecular weight is 301.02 g/mol.
What is the IUPAC name of 2-Bromo-4-(trifluoromethoxy)-6-nitroaniline?
The IUPAC name is 2-bromo-6-nitro-4-(trifluoromethoxy)aniline.
What is the InChI of 2-Bromo-4-(trifluoromethoxy)-6-nitroaniline?
The InChI is InChI=1S/C7H4BrF3N2O3/c8-4-1-3(16-7(9,10)11)2-5(6(4)12)13(14)15/h1-2H,12H2.
What is the InChIKey of 2-Bromo-4-(trifluoromethoxy)-6-nitroaniline?
The InChIKey is YIPBAKXAGVSSDF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-4-(trifluoromethoxy)-6-nitroaniline?
The canonical SMILES is C1=C(C=C(C(=C1[N+](=O)[O-])N)Br)OC(F)(F)F.
What is the CAS number of 2-Bromo-4-(trifluoromethoxy)-6-nitroaniline?
The CAS number is 886499-21-4.
What is the DSSTox Substance ID of 2-Bromo-4-(trifluoromethoxy)-6-nitroaniline?
The DSSTox Substance ID is DTXSID80382199.
What is the XLogP3-AA value of 2-Bromo-4-(trifluoromethoxy)-6-nitroaniline?
The XLogP3-AA value is 3.5.
Is 2-Bromo-4-(trifluoromethoxy)-6-nitroaniline a canonicalized compound?
Yes, it is a canonicalized compound.