CAS
76660-37-2 Purity
96%
76660-37-2 Purity
96%
Inquiry Basket
4-Bromo-2,5-dimethylaniline hydrochloride
CAS
1215545-22-4
Catalog Number
ACM1215545224
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C8H11BrClN.
What is the molecular weight of the compound?
The molecular weight of the compound is 236.53 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-bromo-2,5-dimethylaniline;hydrochloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H10BrN.ClH/c1-5-4-8(10)6(2)3-7(5)9;/h3-4H,10H2,1-2H3;1H.
What is the InChIKey of the compound?
The InChIKey of the compound is GCKFWCSTOCYAOI-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=CC(=C(C=C1Br)C)N.Cl.
What is the CAS number of the compound?
The CAS number of the compound is 1215545-22-4.
What is the exact mass of the compound?
The exact mass of the compound is 234.97634 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 1 hydrogen bond acceptor count.
Recommended Products
