1-N-Boc-4-(4-Bromophenyl)piperidine

• CAS: 769944-78-7
• Catalog Number: ACM769944787
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 1-N-Boc-4-(4-Bromophenyl)piperidine?

The molecular formula is C16H22BrNO2.

What is the molecular weight of 1-N-Boc-4-(4-Bromophenyl)piperidine?

The molecular weight is 340.25 g/mol.

What is the IUPAC name of 1-N-Boc-4-(4-Bromophenyl)piperidine?

The IUPAC name is tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate.

What is the InChI of 1-N-Boc-4-(4-Bromophenyl)piperidine?

The InChI is InChI=1S/C16H22BrNO2/c1-16(2,3)20-15(19)18-10-8-13(9-11-18)12-4-6-14(17)7-5-12/h4-7,13H,8-11H2,1-3H3.

What is the InChIKey of 1-N-Boc-4-(4-Bromophenyl)piperidine?

The InChIKey is UEOHLUHRQWYQRT-UHFFFAOYSA-N.

What is the canonical SMILES of 1-N-Boc-4-(4-Bromophenyl)piperidine?

The canonical SMILES is CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=C(C=C2)Br.

What is the CAS number of 1-N-Boc-4-(4-Bromophenyl)piperidine?

The CAS number is 769944-78-7.

What is the European Community (EC) Number of 1-N-Boc-4-(4-Bromophenyl)piperidine?

The European Community (EC) Number is 873-007-7.

What is the DSSTox Substance ID of 1-N-Boc-4-(4-Bromophenyl)piperidine?

The DSSTox Substance ID is DTXSID20650662.

What is the topological polar surface area of 1-N-Boc-4-(4-Bromophenyl)piperidine?

The topological polar surface area is 29.5 Ų.