What is the molecular formula of 6-Benzyloxy-2-fluoro-3-methylphenylboronic acid?
The molecular formula is C14H14BFO3.
What is the molecular weight of 6-Benzyloxy-2-fluoro-3-methylphenylboronic acid?
The molecular weight is 260.07 g/mol.
When was 6-Benzyloxy-2-fluoro-3-methylphenylboronic acid created?
It was created on August 8, 2012.
When was 6-Benzyloxy-2-fluoro-3-methylphenylboronic acid last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 6-Benzyloxy-2-fluoro-3-methylphenylboronic acid?
The IUPAC name is (2-fluoro-3-methyl-6-phenylmethoxyphenyl)boronic acid.
What is the InChI of 6-Benzyloxy-2-fluoro-3-methylphenylboronic acid?
The InChI is InChI=1S/C14H14BFO3/c1-10-7-8-12(13(14(10)16)15(17)18)19-9-11-5-3-2-4-6-11/h2-8,17-18H,9H2,1H3.
What is the InChIKey of 6-Benzyloxy-2-fluoro-3-methylphenylboronic acid?
The InChIKey is NIAFLFHRTMXSRX-UHFFFAOYSA-N.
What is the canonical SMILES representation of 6-Benzyloxy-2-fluoro-3-methylphenylboronic acid?
The canonical SMILES is B(C1=C(C=CC(=C1F)C)OCC2=CC=CC=C2)(O)O.
How many hydrogen bond donor counts does 6-Benzyloxy-2-fluoro-3-methylphenylboronic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 6-Benzyloxy-2-fluoro-3-methylphenylboronic acid have?
It has 4 hydrogen bond acceptor counts.