CAS
1451391-39-1 Purity
---
1451391-39-1 Purity
---
Inquiry Basket
3,5-Dimethyl-4-formylphenylboronic acid
CAS
1218790-71-6
Catalog Number
ACM1218790716-1
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3,5-Dimethyl-4-formylphenylboronic acid?
The molecular formula is C9H11BO3.
What is the molecular weight of 3,5-Dimethyl-4-formylphenylboronic acid?
The molecular weight is 177.99 g/mol.
What is the IUPAC name of 3,5-Dimethyl-4-formylphenylboronic acid?
The IUPAC name is (4-formyl-3,5-dimethylphenyl)boronic acid.
What is the InChI of 3,5-Dimethyl-4-formylphenylboronic acid?
The InChI is InChI=1S/C9H11BO3/c1-6-3-8(10(12)13)4-7(2)9(6)5-11/h3-5,12-13H,1-2H3.
What is the InChIKey of 3,5-Dimethyl-4-formylphenylboronic acid?
The InChIKey is HMOKNSHYDFAZAZ-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dimethyl-4-formylphenylboronic acid?
The canonical SMILES is B(C1=CC(=C(C(=C1)C)C=O)C)(O)O.
What is the CAS number of 3,5-Dimethyl-4-formylphenylboronic acid?
The CAS number is 1218790-71-6.
How many hydrogen bond donor counts does 3,5-Dimethyl-4-formylphenylboronic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3,5-Dimethyl-4-formylphenylboronic acid have?
It has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 3,5-Dimethyl-4-formylphenylboronic acid have?
It has 2 rotatable bond counts.
Recommended Products
